CAS 1259862-01-5 is the registry number for (R)-1-(5-Chloro-2-(trifluoromethyl)phenyl)ethan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-[5-chloro-2-(trifluoromethyl)phenyl]ethanamine (CAS 1259862-01-5) is a chemical compound with the molecular formula C9H9ClF3N and a molecular weight of 223.62 g/mol. IUPAC name: (1R)-1-[5-chloro-2-(trifluoromethyl)phenyl]ethanamine. InChIKey: HELMSEMDXUXSKO-RXMQYKEDSA-N.
| Molecular formula | C9H9ClF3N |
|---|---|
| Molecular weight | 223.62 g/mol |
| IUPAC name | (1R)-1-[5-chloro-2-(trifluoromethyl)phenyl]ethanamine |
| InChIKey | HELMSEMDXUXSKO-RXMQYKEDSA-N |
| SMILES | C[C@H](C1=C(C=CC(=C1)Cl)C(F)(F)F)N |
Computed by PubChem (NCBI)