Products 1369903-87-6
CAS 1369903-87-6 is the registry number for 4-Chloro-n,n-dimethyl-3-(trifluoromethyl)aniline, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
4-chloro-N,N-dimethyl-3-(trifluoromethyl)aniline (CAS 1369903-87-6) is a chemical compound with the molecular formula C9H9ClF3N and a molecular weight of 223.62 g/mol. IUPAC name: 4-chloro-N,N-dimethyl-3-(trifluoromethyl)aniline. InChIKey: BMNGNYGTIQXUAJ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClF3N |
|---|---|
| Molecular weight | 223.62 g/mol |
| IUPAC name | 4-chloro-N,N-dimethyl-3-(trifluoromethyl)aniline |
| InChIKey | BMNGNYGTIQXUAJ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=C(C=C1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)