Products 1259993-82-2
CAS 1259993-82-2 appears in our catalog under these names: 2-Amino-3-(2-fluoro-3-(trifluoromethyl)phenyl)propanoic acid, 95+%, 2-Fluoro-3-(trifluoromethyl)-dl-phenylalanine, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
2-amino-3-[2-fluoro-3-(trifluoromethyl)phenyl]propanoic acid (CAS 1259993-82-2) is a chemical compound with the molecular formula C10H9F4NO2 and a molecular weight of 251.18 g/mol. IUPAC name: 2-amino-3-[2-fluoro-3-(trifluoromethyl)phenyl]propanoic acid. InChIKey: CMTKGTLWCOCZOE-UHFFFAOYSA-N.
| Molecular formula | C10H9F4NO2 |
|---|---|
| Molecular weight | 251.18 g/mol |
| IUPAC name | 2-amino-3-[2-fluoro-3-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | CMTKGTLWCOCZOE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)F)CC(C(=O)O)N |
Computed by PubChem (NCBI)