Products 1703963-38-5
CAS 1703963-38-5 is the registry number for Methyl (S)-2-amino-2-(4-fluoro-2-(trifluoromethyl)phenyl)acetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-2-amino-2-[4-fluoro-2-(trifluoromethyl)phenyl]acetate (CAS 1703963-38-5) is a chemical compound with the molecular formula C10H9F4NO2 and a molecular weight of 251.18 g/mol. IUPAC name: methyl (2S)-2-amino-2-[4-fluoro-2-(trifluoromethyl)phenyl]acetate. InChIKey: DXRMDWVQIPTLLG-QMMMGPOBSA-N.
| Molecular formula | C10H9F4NO2 |
|---|---|
| Molecular weight | 251.18 g/mol |
| IUPAC name | methyl (2S)-2-amino-2-[4-fluoro-2-(trifluoromethyl)phenyl]acetate |
| InChIKey | DXRMDWVQIPTLLG-QMMMGPOBSA-N |
| SMILES | COC(=O)[C@H](C1=C(C=C(C=C1)F)C(F)(F)F)N |
Computed by PubChem (NCBI)