Products 1259997-93-7
CAS 1259997-93-7 appears in our catalog under these names: 4-Fluoro-2-(trifluoromethyl)-dl-phenylalanine, 95%, 2-Amino-3-(4-fluoro-2-(trifluoromethyl)phenyl)propanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-amino-3-[4-fluoro-2-(trifluoromethyl)phenyl]propanoic acid (CAS 1259997-93-7) is a chemical compound with the molecular formula C10H9F4NO2 and a molecular weight of 251.18 g/mol. IUPAC name: 2-amino-3-[4-fluoro-2-(trifluoromethyl)phenyl]propanoic acid. InChIKey: NICCVNASMKOGPH-UHFFFAOYSA-N.
| Molecular formula | C10H9F4NO2 |
|---|---|
| Molecular weight | 251.18 g/mol |
| IUPAC name | 2-amino-3-[4-fluoro-2-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | NICCVNASMKOGPH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(F)(F)F)CC(C(=O)O)N |
Computed by PubChem (NCBI)