CAS 137233-85-3 is the registry number for 3,6,7,8-Tetrahydro-1(2H)-pyrenone. Offered by: TRC. Available pack sizes: 100mg.
3,6,7,8-tetrahydro-2H-pyren-1-one (CAS 137233-85-3) is a chemical compound with the molecular formula C16H14O and a molecular weight of 222.28 g/mol. IUPAC name: 3,6,7,8-tetrahydro-2H-pyren-1-one. InChIKey: KQFOHQYYSWXLKM-UHFFFAOYSA-N.
| Molecular formula | C16H14O |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | 3,6,7,8-tetrahydro-2H-pyren-1-one |
| InChIKey | KQFOHQYYSWXLKM-UHFFFAOYSA-N |
| SMILES | C1CC2=C3C(=CC=C4C3=C(CCC4=O)C=C2)C1 |
Computed by PubChem (NCBI)