Products 1260385-74-7
CAS 1260385-74-7 appears in our catalog under these names: 5–Amino–7–azaindole–2–carboxylic acid, 5-Amino-1h-pyrrolo[2,3-b]pyridine-2-carboxylic acid, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
5-amino-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (CAS 1260385-74-7) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 5-amino-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid. InChIKey: VWHLUZNJRYXVRE-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 5-amino-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid |
| InChIKey | VWHLUZNJRYXVRE-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(NC2=NC=C1N)C(=O)O |
Computed by PubChem (NCBI)