CAS 1260486-39-2 appears in our catalog under these names: 1-(4-Fluoronaphthalen-1-yl)ethan-1-amine, 95%, 1-(4-Fluoronaphthalen-1-yl)ethan-1-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
1-(4-fluoronaphthalen-1-yl)ethanamine (CAS 1260486-39-2) is a chemical compound with the molecular formula C12H12FN and a molecular weight of 189.23 g/mol. IUPAC name: 1-(4-fluoronaphthalen-1-yl)ethanamine. InChIKey: MVNSJXXBMVYRCM-UHFFFAOYSA-N.
| Molecular formula | C12H12FN |
|---|---|
| Molecular weight | 189.23 g/mol |
| IUPAC name | 1-(4-fluoronaphthalen-1-yl)ethanamine |
| InChIKey | MVNSJXXBMVYRCM-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C2=CC=CC=C21)F)N |
Computed by PubChem (NCBI)