CAS 146135-21-9 is the registry number for 1-(3-Fluorophenyl)-2,5-dimethylpyrrole, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 25g, 5g.
1-(3-fluorophenyl)-2,5-dimethylpyrrole (CAS 146135-21-9) is a chemical compound with the molecular formula C12H12FN and a molecular weight of 189.23 g/mol. IUPAC name: 1-(3-fluorophenyl)-2,5-dimethylpyrrole. InChIKey: WSZMMKRHLWEHTD-UHFFFAOYSA-N.
| Molecular formula | C12H12FN |
|---|---|
| Molecular weight | 189.23 g/mol |
| IUPAC name | 1-(3-fluorophenyl)-2,5-dimethylpyrrole |
| InChIKey | WSZMMKRHLWEHTD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=CC(=CC=C2)F)C |
Computed by PubChem (NCBI)