Products 146135-20-8

CAS 146135-20-8 is the registry number for 1-(2-Fluorophenyl)-2,5-dimethylpyrrole, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 25g, 5g.

Structural formula: {0} (CAS {1})

1-(2-fluorophenyl)-2,5-dimethylpyrrole (CAS 146135-20-8) is a chemical compound with the molecular formula C12H12FN and a molecular weight of 189.23 g/mol. IUPAC name: 1-(2-fluorophenyl)-2,5-dimethylpyrrole. InChIKey: BFSXBLWSHDADPC-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12FN
Molecular weight189.23 g/mol
IUPAC name1-(2-fluorophenyl)-2,5-dimethylpyrrole
InChIKeyBFSXBLWSHDADPC-UHFFFAOYSA-N
SMILESCC1=CC=C(N1C2=CC=CC=C2F)C

Computed by PubChem (NCBI)