CAS 1260590-21-3 is the registry number for (2S)-2-(3-Bromophenyl)-2-({((9H-fluoren-9-yl)methoxy)carbonyl}amino)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2S)-2-(3-bromophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (CAS 1260590-21-3) is a chemical compound with the molecular formula C23H18BrNO4 and a molecular weight of 452.3 g/mol. IUPAC name: (2S)-2-(3-bromophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid. InChIKey: UQJPQTKGTUVCOE-NRFANRHFSA-N.
| Molecular formula | C23H18BrNO4 |
|---|---|
| Molecular weight | 452.3 g/mol |
| IUPAC name | (2S)-2-(3-bromophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| InChIKey | UQJPQTKGTUVCOE-NRFANRHFSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](C4=CC(=CC=C4)Br)C(=O)O |
Computed by PubChem (NCBI)