CAS 1697522-98-7 is the registry number for 2-(3-Bromophenyl)-2-(([(9h-fluoren-9-yl)methoxy]carbonyl)amino)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
2-(3-bromophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (CAS 1697522-98-7) is a chemical compound with the molecular formula C23H18BrNO4 and a molecular weight of 452.3 g/mol. IUPAC name: 2-(3-bromophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid. InChIKey: UQJPQTKGTUVCOE-UHFFFAOYSA-N.
| Molecular formula | C23H18BrNO4 |
|---|---|
| Molecular weight | 452.3 g/mol |
| IUPAC name | 2-(3-bromophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| InChIKey | UQJPQTKGTUVCOE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(C4=CC(=CC=C4)Br)C(=O)O |
Computed by PubChem (NCBI)