CAS 1260592-26-4 is the registry number for (S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-2-(4-bromophenyl)acetic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2S)-2-(4-bromophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (CAS 1260592-26-4) is a chemical compound with the molecular formula C23H18BrNO4 and a molecular weight of 452.3 g/mol. IUPAC name: (2S)-2-(4-bromophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid. InChIKey: YZEMVMPFMBPCHY-NRFANRHFSA-N.
| Molecular formula | C23H18BrNO4 |
|---|---|
| Molecular weight | 452.3 g/mol |
| IUPAC name | (2S)-2-(4-bromophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| InChIKey | YZEMVMPFMBPCHY-NRFANRHFSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](C4=CC=C(C=C4)Br)C(=O)O |
Computed by PubChem (NCBI)