CAS 1260590-97-3 is the registry number for (R)-5,6-DIMETHOXY-2,3-DIHYDRO-1H-INDEN-1-AMINE, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(1R)-5,6-dimethoxy-2,3-dihydro-1H-inden-1-amine (CAS 1260590-97-3) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: (1R)-5,6-dimethoxy-2,3-dihydro-1H-inden-1-amine. InChIKey: PMFJDFRZFOSMSM-SECBINFHSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | (1R)-5,6-dimethoxy-2,3-dihydro-1H-inden-1-amine |
| InChIKey | PMFJDFRZFOSMSM-SECBINFHSA-N |
| SMILES | COC1=C(C=C2[C@@H](CCC2=C1)N)OC |
Computed by PubChem (NCBI)