CAS 1260591-74-9 appears in our catalog under these names: (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-(naphthalen-1-yl)acetic acid, 98%, 98%, Fmoc-Gly((1-Naphthyl)-OH, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 25mg, 1g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-naphthalen-1-ylacetic acid (CAS 1260591-74-9) is a chemical compound with the molecular formula C27H21NO4 and a molecular weight of 423.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-naphthalen-1-ylacetic acid. InChIKey: SCQIIBIYCFZYJE-VWLOTQADSA-N.
| Molecular formula | C27H21NO4 |
|---|---|
| Molecular weight | 423.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-naphthalen-1-ylacetic acid |
| InChIKey | SCQIIBIYCFZYJE-VWLOTQADSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)