CAS 369403-40-7 appears in our catalog under these names: 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-(naphthalen-2-yl)acetic acid, 95%, 2-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)-2-(naphthalen-2-yl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-naphthalen-2-ylacetic acid (CAS 369403-40-7) is a chemical compound with the molecular formula C27H21NO4 and a molecular weight of 423.5 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-naphthalen-2-ylacetic acid. InChIKey: XWRGISZRUVIDKT-UHFFFAOYSA-N.
| Molecular formula | C27H21NO4 |
|---|---|
| Molecular weight | 423.5 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-naphthalen-2-ylacetic acid |
| InChIKey | XWRGISZRUVIDKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)