Products 2230808-66-7
CAS 2230808-66-7 is the registry number for 6-(({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)methyl)naphthalene-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]naphthalene-2-carboxylic acid (CAS 2230808-66-7) is a chemical compound with the molecular formula C27H21NO4 and a molecular weight of 423.5 g/mol. IUPAC name: 6-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]naphthalene-2-carboxylic acid. InChIKey: FGKZQBJHVBLRKV-UHFFFAOYSA-N.
| Molecular formula | C27H21NO4 |
|---|---|
| Molecular weight | 423.5 g/mol |
| IUPAC name | 6-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]naphthalene-2-carboxylic acid |
| InChIKey | FGKZQBJHVBLRKV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC4=CC5=C(C=C4)C=C(C=C5)C(=O)O |
Computed by PubChem (NCBI)