CAS 1260594-42-0 is the registry number for Fmoc-3-fluoro-D-homophenylalanine, ≥95%(210nm), ≥95%(210nm). Offered by: Chemat. Available pack sizes: 250mg, 1g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-fluorophenyl)butanoic acid (CAS 1260594-42-0) is a chemical compound with the molecular formula C25H22FNO4 and a molecular weight of 419.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-fluorophenyl)butanoic acid. InChIKey: USLBDGLIEZPUPZ-HSZRJFAPSA-N.
| Molecular formula | C25H22FNO4 |
|---|---|
| Molecular weight | 419.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-fluorophenyl)butanoic acid |
| InChIKey | USLBDGLIEZPUPZ-HSZRJFAPSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCC4=CC(=CC=C4)F)C(=O)O |
Computed by PubChem (NCBI)