CAS 1260602-67-2 is the registry number for (2S,4S)-1-(tert-Butoxycarbonyl)-4-fluoropiperidine-2-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
(2S,4S)-4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid (CAS 1260602-67-2) is a chemical compound with the molecular formula C11H18FNO4 and a molecular weight of 247.26 g/mol. IUPAC name: (2S,4S)-4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid. InChIKey: HTEKKPRKMGEXAE-YUMQZZPRSA-N.
| Molecular formula | C11H18FNO4 |
|---|---|
| Molecular weight | 247.26 g/mol |
| IUPAC name | (2S,4S)-4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid |
| InChIKey | HTEKKPRKMGEXAE-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C[C@H]1C(=O)O)F |
Computed by PubChem (NCBI)