CAS 1260604-62-3 appears in our catalog under these names: (S)–3–tert–butoxycarbonylamino–3–cyclobutyl–propionic acid, (S)-3-((tert-Butoxycarbonyl)amino)-3-cyclobutylpropanoic acid, 97%, (S)-3-tert-butoxycarbonylamino-3-cyclobutyl-propionic acid, 95%, 95%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g.
(3S)-3-cyclobutyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1260604-62-3) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (3S)-3-cyclobutyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: DSBXGUITJZILAS-VIFPVBQESA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (3S)-3-cyclobutyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | DSBXGUITJZILAS-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)O)C1CCC1 |
Computed by PubChem (NCBI)