CAS 1260607-46-2 is the registry number for (R)-3-((tert-Butoxycarbonyl)amino)-2-(2-chlorobenzyl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-[(2-chlorophenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1260607-46-2) is a chemical compound with the molecular formula C15H20ClNO4 and a molecular weight of 313.77 g/mol. IUPAC name: (2R)-2-[(2-chlorophenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: IUNCSGRILLTZRZ-LLVKDONJSA-N.
| Molecular formula | C15H20ClNO4 |
|---|---|
| Molecular weight | 313.77 g/mol |
| IUPAC name | (2R)-2-[(2-chlorophenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | IUNCSGRILLTZRZ-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](CC1=CC=CC=C1Cl)C(=O)O |
Computed by PubChem (NCBI)