CAS 1260609-71-9 appears in our catalog under these names: (R)-Chroman-3-carboxylic acid, 95%, (R)-Chroman-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 10g.
(3R)-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 1260609-71-9) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: (3R)-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: UGAGZMGJJFSKQM-MRVPVSSYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | (3R)-3,4-dihydro-2H-chromene-3-carboxylic acid |
| InChIKey | UGAGZMGJJFSKQM-MRVPVSSYSA-N |
| SMILES | C1[C@H](COC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)