Products 1260611-28-6
CAS 1260611-28-6 is the registry number for (R)-2-(2-Bromobenzyl)-3-((tert-butoxycarbonyl)amino)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-[(2-bromophenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1260611-28-6) is a chemical compound with the molecular formula C15H20BrNO4 and a molecular weight of 358.23 g/mol. IUPAC name: (2R)-2-[(2-bromophenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: SQUBOYNYBZABGR-LLVKDONJSA-N.
| Molecular formula | C15H20BrNO4 |
|---|---|
| Molecular weight | 358.23 g/mol |
| IUPAC name | (2R)-2-[(2-bromophenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | SQUBOYNYBZABGR-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](CC1=CC=CC=C1Br)C(=O)O |
Computed by PubChem (NCBI)