Products 1260616-34-9
CAS 1260616-34-9 is the registry number for (R)-tert-Butyl 2-(tert-Butoxycarbonylamino)-5-oxo-5-phenylpentanoate. Offered by: TRC. Available pack sizes: 2,5g.
Tert-butyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylpentanoate (CAS 1260616-34-9) is a chemical compound with the molecular formula C20H29NO5 and a molecular weight of 363.4 g/mol. IUPAC name: tert-butyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylpentanoate. InChIKey: GQSXJAJHFGIAJQ-OAHLLOKOSA-N.
| Molecular formula | C20H29NO5 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | tert-butyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylpentanoate |
| InChIKey | GQSXJAJHFGIAJQ-OAHLLOKOSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H](CCC(=O)C1=CC=CC=C1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)