CAS 135383-54-9 is the registry number for Monomethyl auristatin E intermediate-6. Offered by: MedChemExpress. Available pack sizes: Get quote.
Tert-butyl (4S,5S)-5-methyl-3-oxo-4-(phenylmethoxycarbonylamino)heptanoate (CAS 135383-54-9) is a chemical compound with the molecular formula C20H29NO5 and a molecular weight of 363.4 g/mol. IUPAC name: tert-butyl (4S,5S)-5-methyl-3-oxo-4-(phenylmethoxycarbonylamino)heptanoate. InChIKey: OBDXBUWPBDVKEB-KSSFIOAISA-N.
| Molecular formula | C20H29NO5 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | tert-butyl (4S,5S)-5-methyl-3-oxo-4-(phenylmethoxycarbonylamino)heptanoate |
| InChIKey | OBDXBUWPBDVKEB-KSSFIOAISA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)CC(=O)OC(C)(C)C)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)