Products 173653-47-9
CAS 173653-47-9 appears in our catalog under these names: Monomethyl auristatin E intermediate–15, Monomethyl auristatin E intermediate-15, 96%, 96%, Monomethyl auristatin E intermediate-15, 95.04%, tert-Butyl (S)-2-((1R,2S)-3-(benzyloxy)-1-hydroxy-2-methyl-3-oxopropyl)pyrrolidine-1-carboxylate, 96%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 25mg, 50mg, 100mg, 50 mg, 25 mg, 250mg.
Tert-butyl (2S)-2-[(1R,2S)-1-hydroxy-2-methyl-3-oxo-3-phenylmethoxypropyl]pyrrolidine-1-carboxylate (CAS 173653-47-9) is a chemical compound with the molecular formula C20H29NO5 and a molecular weight of 363.4 g/mol. IUPAC name: tert-butyl (2S)-2-[(1R,2S)-1-hydroxy-2-methyl-3-oxo-3-phenylmethoxypropyl]pyrrolidine-1-carboxylate. InChIKey: IJTMTCBOXNAACY-BHYGNILZSA-N.
| Molecular formula | C20H29NO5 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | tert-butyl (2S)-2-[(1R,2S)-1-hydroxy-2-methyl-3-oxo-3-phenylmethoxypropyl]pyrrolidine-1-carboxylate |
| InChIKey | IJTMTCBOXNAACY-BHYGNILZSA-N |
| SMILES | C[C@@H]([C@H]([C@@H]1CCCN1C(=O)OC(C)(C)C)O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
Monomethyl auristatin E intermediate-15