Products 1260619-56-4
CAS 1260619-56-4 appears in our catalog under these names: Abacavir-d4, Abacavir-d4 (cyclopropyl-2,2,3,3-d4), 99 atom % D, min 98% Chemical Purity, Abacavir–d4. Offered by: Chemat Brand, CDN, GLPBio, MedChemExpress. Available pack sizes: on request, 0,01g, 0,005g, 1mg, 500μg, 1 mg.
[(1S,4R)-4-[2-amino-6-[(2,2,3,3-tetradeuteriocyclopropyl)amino]purin-9-yl]cyclopent-2-en-1-yl]methanol (CAS 1260619-56-4) is a chemical compound with the molecular formula C14H18N6O and a molecular weight of 290.36 g/mol. IUPAC name: [(1S,4R)-4-[2-amino-6-[(2,2,3,3-tetradeuteriocyclopropyl)amino]purin-9-yl]cyclopent-2-en-1-yl]methanol. InChIKey: MCGSCOLBFJQGHM-ZOTQTBSBSA-N.
| Molecular formula | C14H18N6O |
|---|---|
| Molecular weight | 290.36 g/mol |
| IUPAC name | [(1S,4R)-4-[2-amino-6-[(2,2,3,3-tetradeuteriocyclopropyl)amino]purin-9-yl]cyclopent-2-en-1-yl]methanol |
| InChIKey | MCGSCOLBFJQGHM-ZOTQTBSBSA-N |
| SMILES | [2H]C1(C(C1([2H])[2H])NC2=C3C(=NC(=N2)N)N(C=N3)[C@@H]4C[C@@H](C=C4)CO)[2H] |
Computed by PubChem (NCBI)