CAS 1443421-67-7 appears in our catalog under these names: Abacavir sulfate EP Impurity D, (R,R)-Abacavir. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
[(1R,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methanol (CAS 1443421-67-7) is a chemical compound with the molecular formula C14H18N6O and a molecular weight of 286.33 g/mol. IUPAC name: [(1R,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methanol. InChIKey: MCGSCOLBFJQGHM-WPRPVWTQSA-N.
| Molecular formula | C14H18N6O |
|---|---|
| Molecular weight | 286.33 g/mol |
| IUPAC name | [(1R,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methanol |
| InChIKey | MCGSCOLBFJQGHM-WPRPVWTQSA-N |
| SMILES | C1CC1NC2=C3C(=NC(=N2)N)N(C=N3)[C@@H]4C[C@H](C=C4)CO |
Computed by PubChem (NCBI)