Products 2079853-44-2
CAS 2079853-44-2 is the registry number for Abacavir Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
[(1S,4S)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methanol (CAS 2079853-44-2) is a chemical compound with the molecular formula C14H18N6O and a molecular weight of 286.33 g/mol. IUPAC name: [(1S,4S)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methanol. InChIKey: MCGSCOLBFJQGHM-PSASIEDQSA-N.
| Molecular formula | C14H18N6O |
|---|---|
| Molecular weight | 286.33 g/mol |
| IUPAC name | [(1S,4S)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methanol |
| InChIKey | MCGSCOLBFJQGHM-PSASIEDQSA-N |
| SMILES | C1CC1NC2=C3C(=NC(=N2)N)N(C=N3)[C@H]4C[C@@H](C=C4)CO |
Computed by PubChem (NCBI)