Products 1260637-34-0
CAS 1260637-34-0 is the registry number for Ethyl 3-{((tert-butoxy)carbonyl)amino}-6-oxabicyclo(3.1.0)hexane-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxabicyclo[3.1.0]hexane-3-carboxylate (CAS 1260637-34-0) is a chemical compound with the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. IUPAC name: ethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxabicyclo[3.1.0]hexane-3-carboxylate. InChIKey: RJOKDPCWAVIFKW-UHFFFAOYSA-N.
| Molecular formula | C13H21NO5 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | ethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxabicyclo[3.1.0]hexane-3-carboxylate |
| InChIKey | RJOKDPCWAVIFKW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CC2C(C1)O2)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)