Products 1260642-93-0
CAS 1260642-93-0 is the registry number for 5-(Trifluoromethyl)-1H-benzo[d]imidazole hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
6-(trifluoromethyl)-1H-benzimidazole;hydrochloride (CAS 1260642-93-0) is a chemical compound with the molecular formula C8H6ClF3N2 and a molecular weight of 222.59 g/mol. IUPAC name: 6-(trifluoromethyl)-1H-benzimidazole;hydrochloride. InChIKey: UTXTYBVGNRTFLR-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3N2 |
|---|---|
| Molecular weight | 222.59 g/mol |
| IUPAC name | 6-(trifluoromethyl)-1H-benzimidazole;hydrochloride |
| InChIKey | UTXTYBVGNRTFLR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)NC=N2.Cl |
Computed by PubChem (NCBI)