CAS 953781-55-0 is the registry number for 2,2,2-Trifluoro-N-(3-methylpyridin-2-yl)acetimidoyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trifluoro-N-(3-methyl-2-pyridinyl)ethanimidoyl chloride (CAS 953781-55-0) is a chemical compound with the molecular formula C8H6ClF3N2 and a molecular weight of 222.59 g/mol. IUPAC name: 2,2,2-trifluoro-N-(3-methyl-2-pyridinyl)ethanimidoyl chloride. InChIKey: PELPZBYULAYTRQ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3N2 |
|---|---|
| Molecular weight | 222.59 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-(3-methyl-2-pyridinyl)ethanimidoyl chloride |
| InChIKey | PELPZBYULAYTRQ-UHFFFAOYSA-N |
| SMILES | CC1=C(N=CC=C1)N=C(C(F)(F)F)Cl |
Computed by PubChem (NCBI)