CAS 2065250-11-3 appears in our catalog under these names: 5-Trifluoromethyl-imidazo[1,2-a]pyridine hydrochloride, 95%, 5-(Trifluoromethyl)imidazo(1,2-a)pyridine hydrochloride, 98%, 5-(Trifluoromethyl)imidazo[1,2-a]pyridine hydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 10g, 250mg.
5-(trifluoromethyl)imidazo[1,2-a]pyridine;hydrochloride (CAS 2065250-11-3) is a chemical compound with the molecular formula C8H6ClF3N2 and a molecular weight of 222.59 g/mol. IUPAC name: 5-(trifluoromethyl)imidazo[1,2-a]pyridine;hydrochloride. InChIKey: WLCHVEOHBFJMQL-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3N2 |
|---|---|
| Molecular weight | 222.59 g/mol |
| IUPAC name | 5-(trifluoromethyl)imidazo[1,2-a]pyridine;hydrochloride |
| InChIKey | WLCHVEOHBFJMQL-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CN2C(=C1)C(F)(F)F.Cl |
Computed by PubChem (NCBI)