Products 1260664-14-9
CAS 1260664-14-9 is the registry number for Methyl 5-bromo-2-((tert-butoxycarbonyl)amino)isonicotinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-4-carboxylate (CAS 1260664-14-9) is a chemical compound with the molecular formula C12H15BrN2O4 and a molecular weight of 331.16 g/mol. IUPAC name: methyl 5-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-4-carboxylate. InChIKey: KUELGSGFHYZLHG-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2O4 |
|---|---|
| Molecular weight | 331.16 g/mol |
| IUPAC name | methyl 5-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-4-carboxylate |
| InChIKey | KUELGSGFHYZLHG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC=C(C(=C1)C(=O)OC)Br |
Computed by PubChem (NCBI)