CAS 948594-79-4 is the registry number for tert-Butyl methyl 2-(5-bromopyrimidin-2-yl)malonate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
3-O-tert-butyl 1-O-methyl 2-(5-bromopyrimidin-2-yl)propanedioate (CAS 948594-79-4) is a chemical compound with the molecular formula C12H15BrN2O4 and a molecular weight of 331.16 g/mol. IUPAC name: 3-O-tert-butyl 1-O-methyl 2-(5-bromopyrimidin-2-yl)propanedioate. InChIKey: ATYNGAOEFUBJIW-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2O4 |
|---|---|
| Molecular weight | 331.16 g/mol |
| IUPAC name | 3-O-tert-butyl 1-O-methyl 2-(5-bromopyrimidin-2-yl)propanedioate |
| InChIKey | ATYNGAOEFUBJIW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(C1=NC=C(C=N1)Br)C(=O)OC |
Computed by PubChem (NCBI)