Products 2301069-15-6

CAS 2301069-15-6 is the registry number for (3-Bromo-5-nitro-benzyl)-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Tert-butyl N-[(3-bromo-5-nitrophenyl)methyl]carbamate (CAS 2301069-15-6) is a chemical compound with the molecular formula C12H15BrN2O4 and a molecular weight of 331.16 g/mol. IUPAC name: tert-butyl N-[(3-bromo-5-nitrophenyl)methyl]carbamate. InChIKey: WGCMRCHPANMQOR-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15BrN2O4
Molecular weight331.16 g/mol
IUPAC nametert-butyl N-[(3-bromo-5-nitrophenyl)methyl]carbamate
InChIKeyWGCMRCHPANMQOR-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCC1=CC(=CC(=C1)Br)[N+](=O)[O-]

Computed by PubChem (NCBI)