Products 1260665-72-2
CAS 1260665-72-2 is the registry number for Ethyl 3H-imidazo[4,5-b]pyridine-5-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 1H-imidazo[4,5-b]pyridine-5-carboxylate (CAS 1260665-72-2) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: ethyl 1H-imidazo[4,5-b]pyridine-5-carboxylate. InChIKey: ZBFFJRBCVMPLRM-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | ethyl 1H-imidazo[4,5-b]pyridine-5-carboxylate |
| InChIKey | ZBFFJRBCVMPLRM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(C=C1)NC=N2 |
Computed by PubChem (NCBI)