CAS 1260666-75-8 is the registry number for 1-Bromo-5-chloro-2,6-naphthyridine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-5-chloro-2,6-naphthyridine (CAS 1260666-75-8) is a chemical compound with the molecular formula C8H4BrClN2 and a molecular weight of 243.49 g/mol. IUPAC name: 1-bromo-5-chloro-2,6-naphthyridine. InChIKey: LFJZOHGPQGMJSG-UHFFFAOYSA-N.
| Molecular formula | C8H4BrClN2 |
|---|---|
| Molecular weight | 243.49 g/mol |
| IUPAC name | 1-bromo-5-chloro-2,6-naphthyridine |
| InChIKey | LFJZOHGPQGMJSG-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C2=C1C(=NC=C2)Br)Cl |
Computed by PubChem (NCBI)