Products 897297-92-6
CAS 897297-92-6 is the registry number for 5-Bromo-N-(2-oxo-2-(pyrrolidin-1-yl)ethyl)furan-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-N-(2-oxo-2-pyrrolidin-1-ylethyl)furan-2-carboxamide (CAS 897297-92-6) is a chemical compound with the molecular formula C11H13BrN2O3 and a molecular weight of 301.14 g/mol. IUPAC name: 5-bromo-N-(2-oxo-2-pyrrolidin-1-ylethyl)furan-2-carboxamide. InChIKey: DTJANDFSPQTIEQ-UHFFFAOYSA-N.
| Molecular formula | C11H13BrN2O3 |
|---|---|
| Molecular weight | 301.14 g/mol |
| IUPAC name | 5-bromo-N-(2-oxo-2-pyrrolidin-1-ylethyl)furan-2-carboxamide |
| InChIKey | DTJANDFSPQTIEQ-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)CNC(=O)C2=CC=C(O2)Br |
Computed by PubChem (NCBI)