CAS 1260671-85-9 is the registry number for tert-Butyl 3-formyl-5,8-dihydro-1,7-naphthyridine-7(6H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-formyl-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylate (CAS 1260671-85-9) is a chemical compound with the molecular formula C14H18N2O3 and a molecular weight of 262.30 g/mol. IUPAC name: tert-butyl 3-formyl-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylate. InChIKey: LXXZGXRYDBHDAJ-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O3 |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | tert-butyl 3-formyl-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylate |
| InChIKey | LXXZGXRYDBHDAJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)N=CC(=C2)C=O |
Computed by PubChem (NCBI)