Products 1260672-25-0
CAS 1260672-25-0 is the registry number for 1-(4-Nitrophenyl)Cyclobutan-1-Amine, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
1-(4-nitrophenyl)cyclobutan-1-amine (CAS 1260672-25-0) is a chemical compound with the molecular formula C10H12N2O2 and a molecular weight of 192.21 g/mol. IUPAC name: 1-(4-nitrophenyl)cyclobutan-1-amine. InChIKey: ZJRQRRUUGNADQN-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O2 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 1-(4-nitrophenyl)cyclobutan-1-amine |
| InChIKey | ZJRQRRUUGNADQN-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC=C(C=C2)[N+](=O)[O-])N |
Computed by PubChem (NCBI)