Products 1260674-83-6
CAS 1260674-83-6 is the registry number for 2–(6–BroMopyridin–2–yl)aceticacidhydrochloride. Offered by: GLPBio. Available pack sizes: 1g.
2-(6-bromo-2-pyridinyl)acetic acid;hydrochloride (CAS 1260674-83-6) is a chemical compound with the molecular formula C7H7BrClNO2 and a molecular weight of 252.49 g/mol. IUPAC name: 2-(6-bromo-2-pyridinyl)acetic acid;hydrochloride. InChIKey: YRRVBPKOWAXSQK-UHFFFAOYSA-N.
| Molecular formula | C7H7BrClNO2 |
|---|---|
| Molecular weight | 252.49 g/mol |
| IUPAC name | 2-(6-bromo-2-pyridinyl)acetic acid;hydrochloride |
| InChIKey | YRRVBPKOWAXSQK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Br)CC(=O)O.Cl |
Computed by PubChem (NCBI)