CAS 1917346-65-6 appears in our catalog under these names: 5-Bromo-3-chloro-2,6-dimethoxypyridine, 95%, 5-Bromo-3-chloro-2,6-dimethoxypyridine. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
3-bromo-5-chloro-2,6-dimethoxypyridine (CAS 1917346-65-6) is a chemical compound with the molecular formula C7H7BrClNO2 and a molecular weight of 252.49 g/mol. IUPAC name: 3-bromo-5-chloro-2,6-dimethoxypyridine. InChIKey: KOYNSIXIWRTUMI-UHFFFAOYSA-N.
| Molecular formula | C7H7BrClNO2 |
|---|---|
| Molecular weight | 252.49 g/mol |
| IUPAC name | 3-bromo-5-chloro-2,6-dimethoxypyridine |
| InChIKey | KOYNSIXIWRTUMI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=N1)OC)Cl)Br |
Computed by PubChem (NCBI)