Products 61566-59-4

CAS 61566-59-4 is the registry number for 4-Amino-2-bromobenzoic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

4-amino-2-bromobenzoic acid;hydrochloride (CAS 61566-59-4) is a chemical compound with the molecular formula C7H7BrClNO2 and a molecular weight of 252.49 g/mol. IUPAC name: 4-amino-2-bromobenzoic acid;hydrochloride. InChIKey: YCRVYJYVSUDRNC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7BrClNO2
Molecular weight252.49 g/mol
IUPAC name4-amino-2-bromobenzoic acid;hydrochloride
InChIKeyYCRVYJYVSUDRNC-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1N)Br)C(=O)O.Cl

Computed by PubChem (NCBI)