CAS 61566-59-4 is the registry number for 4-Amino-2-bromobenzoic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-amino-2-bromobenzoic acid;hydrochloride (CAS 61566-59-4) is a chemical compound with the molecular formula C7H7BrClNO2 and a molecular weight of 252.49 g/mol. IUPAC name: 4-amino-2-bromobenzoic acid;hydrochloride. InChIKey: YCRVYJYVSUDRNC-UHFFFAOYSA-N.
| Molecular formula | C7H7BrClNO2 |
|---|---|
| Molecular weight | 252.49 g/mol |
| IUPAC name | 4-amino-2-bromobenzoic acid;hydrochloride |
| InChIKey | YCRVYJYVSUDRNC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)Br)C(=O)O.Cl |
Computed by PubChem (NCBI)