CAS 1260752-23-5 appears in our catalog under these names: 1-(3-Bromo-4-methoxyphenyl)cyclopropane-1-carboxylic acid, 98%, 98%, 1-(3-Bromo-4-methoxyphenyl)cyclopropane-1-carboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
1-(3-bromo-4-methoxyphenyl)cyclopropane-1-carboxylic acid (CAS 1260752-23-5) is a chemical compound with the molecular formula C11H11BrO3 and a molecular weight of 271.11 g/mol. IUPAC name: 1-(3-bromo-4-methoxyphenyl)cyclopropane-1-carboxylic acid. InChIKey: LYGXMBZITQVKIZ-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO3 |
|---|---|
| Molecular weight | 271.11 g/mol |
| IUPAC name | 1-(3-bromo-4-methoxyphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | LYGXMBZITQVKIZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2(CC2)C(=O)O)Br |
Computed by PubChem (NCBI)