Products 1260757-30-9
CAS 1260757-30-9 is the registry number for 4-{((tert-Butoxy)carbonyl)amino}-4-methylpent-2-ynoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-ynoic acid (CAS 1260757-30-9) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: 4-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-ynoic acid. InChIKey: MASDBJOBJUMOTH-UHFFFAOYSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 4-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-ynoic acid |
| InChIKey | MASDBJOBJUMOTH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)C#CC(=O)O |
Computed by PubChem (NCBI)