Products 1260770-60-2

CAS 1260770-60-2 is the registry number for 7-bromo-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

7-bromo-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid (CAS 1260770-60-2) is a chemical compound with the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. IUPAC name: 7-bromo-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid. InChIKey: LURAXAHWVHYZKT-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11BrO2
Molecular weight255.11 g/mol
IUPAC name7-bromo-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid
InChIKeyLURAXAHWVHYZKT-UHFFFAOYSA-N
SMILESC1CC2=C(CC1C(=O)O)C=C(C=C2)Br

Computed by PubChem (NCBI)