CAS 1260770-60-2 is the registry number for 7-bromo-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
7-bromo-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid (CAS 1260770-60-2) is a chemical compound with the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. IUPAC name: 7-bromo-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid. InChIKey: LURAXAHWVHYZKT-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO2 |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | 7-bromo-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid |
| InChIKey | LURAXAHWVHYZKT-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1C(=O)O)C=C(C=C2)Br |
Computed by PubChem (NCBI)