CAS 149506-16-1 appears in our catalog under these names: 3-(4-Bromophenyl)cyclobutane-1-carboxylic acid, 95%, 3–(4–Bromophenyl)cyclobutanecarboxylic acid, 3-(4-bromophenyl)cyclobutanecarboxylic acid, 3-(4-Bromophenyl)cyclobutanecarboxylic acid 95%, 3-(4-Bromophenyl)cyclobutanecarboxylic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
3-(4-bromophenyl)cyclobutane-1-carboxylic acid (CAS 149506-16-1) is a chemical compound with the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. IUPAC name: 3-(4-bromophenyl)cyclobutane-1-carboxylic acid. InChIKey: UFECYRKDVGFGLA-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO2 |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | 3-(4-bromophenyl)cyclobutane-1-carboxylic acid |
| InChIKey | UFECYRKDVGFGLA-UHFFFAOYSA-N |
| SMILES | C1C(CC1C(=O)O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)