CAS 1416979-61-7 is the registry number for Ethyl 2-bromo-4-vinylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Ethyl 2-bromo-4-ethenylbenzoate (CAS 1416979-61-7) is a chemical compound with the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. IUPAC name: ethyl 2-bromo-4-ethenylbenzoate. InChIKey: AZDZDLBOLLTQER-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO2 |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | ethyl 2-bromo-4-ethenylbenzoate |
| InChIKey | AZDZDLBOLLTQER-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1)C=C)Br |
Computed by PubChem (NCBI)