Products 1260778-44-6
CAS 1260778-44-6 is the registry number for 1–(4–chloro–3–(trifluoromethyl)phenyl)cyclopropane–1–amine hydrochloride. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
1-[4-chloro-3-(trifluoromethyl)phenyl]cyclopropan-1-amine (CAS 1260778-44-6) is a chemical compound with the molecular formula C10H9ClF3N and a molecular weight of 235.63 g/mol. IUPAC name: 1-[4-chloro-3-(trifluoromethyl)phenyl]cyclopropan-1-amine. InChIKey: QXEPVKCIFNZGCU-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF3N |
|---|---|
| Molecular weight | 235.63 g/mol |
| IUPAC name | 1-[4-chloro-3-(trifluoromethyl)phenyl]cyclopropan-1-amine |
| InChIKey | QXEPVKCIFNZGCU-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC(=C(C=C2)Cl)C(F)(F)F)N |
Computed by PubChem (NCBI)